C10H5F4NOS — CID 152598086
4-[2-fluoro-3-(trifluoromethoxy)phenyl]-1,3-thiazole (PubChem CID 152598086) has the molecular formula C10H5F4NOS and a molecular weight of 263.22 g/mol. Its IUPAC name is 4-[2-fluoro-3-(trifluoromethoxy)phenyl]-1,3-thiazole.
| Compound Name | 4-[2-fluoro-3-(trifluoromethoxy)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 152598086 |
| Molecular Formula | C10H5F4NOS |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 4-[2-fluoro-3-(trifluoromethoxy)phenyl]-1,3-thiazole |
| SMILES | Fc1c(OC(F)(F)F)cccc1-c1cscn1 |
| InChI | InChI=1S/C10H5F4NOS/c11-9-6(7-4-17-5-15-7)2-1-3-8(9)16-10(12,13)14/h1-5H |
| InChIKey | YWXSEEHYVRXQGD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |