C12H6Cl2F3NO — CID 134617905
2,4-dichloro-3-[2-(trifluoromethoxy)phenyl]pyridine (PubChem CID 134617905) has the molecular formula C12H6Cl2F3NO and a molecular weight of 308.09 g/mol. Its IUPAC name is 2,4-dichloro-3-[2-(trifluoromethoxy)phenyl]pyridine.
| Compound Name | 2,4-dichloro-3-[2-(trifluoromethoxy)phenyl]pyridine |
|---|---|
| PubChem CID | 134617905 |
| Molecular Formula | C12H6Cl2F3NO |
| Molecular Weight | 308.09 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 2,4-dichloro-3-[2-(trifluoromethoxy)phenyl]pyridine |
| SMILES | FC(F)(F)Oc1ccccc1-c1c(Cl)ccnc1Cl |
| InChI | InChI=1S/C12H6Cl2F3NO/c13-8-5-6-18-11(14)10(8)7-3-1-2-4-9(7)19-12(15,16)17/h1-6H |
| InChIKey | HKQRHKAFCCANMA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.09 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|