C16H16N2O3 — CID 43158243
3-[2-(furan-2-yl)ethyl]-4-(2-methoxyphenyl)-1,2-oxazol-5-amine (PubChem CID 43158243) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is 3-[2-(furan-2-yl)ethyl]-4-(2-methoxyphenyl)-1,2-oxazol-5-amine.
| Compound Name | 3-[2-(furan-2-yl)ethyl]-4-(2-methoxyphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 43158243 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-[2-(furan-2-yl)ethyl]-4-(2-methoxyphenyl)-1,2-oxazol-5-amine |
| SMILES | COc1ccccc1-c1c(CCc2ccco2)noc1N |
| InChI | InChI=1S/C16H16N2O3/c1-19-14-7-3-2-6-12(14)15-13(18-21-16(15)17)9-8-11-5-4-10-20-11/h2-7,10H,8-9,17H2,1H3 |
| InChIKey | LOTNQBVPTXHPHN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |