C14H14N2OS2 — CID 66199989
4-thiophen-2-yl-5-(3-thiophen-2-ylpropyl)-1,2-oxazol-3-amine (PubChem CID 66199989) has the molecular formula C14H14N2OS2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-thiophen-2-yl-5-(3-thiophen-2-ylpropyl)-1,2-oxazol-3-amine.
| Compound Name | 4-thiophen-2-yl-5-(3-thiophen-2-ylpropyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66199989 |
| Molecular Formula | C14H14N2OS2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 4-thiophen-2-yl-5-(3-thiophen-2-ylpropyl)-1,2-oxazol-3-amine |
| SMILES | Nc1noc(CCCc2cccs2)c1-c1cccs1 |
| InChI | InChI=1S/C14H14N2OS2/c15-14-13(12-7-3-9-19-12)11(17-16-14)6-1-4-10-5-2-8-18-10/h2-3,5,7-9H,1,4,6H2,(H2,15,16) |
| InChIKey | ZTWSKMCOQZRONP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |