C16H16N2OS — CID 66199378
5-[2-(2-methylphenyl)ethyl]-4-thiophen-2-yl-1,2-oxazol-3-amine (PubChem CID 66199378) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is 5-[2-(2-methylphenyl)ethyl]-4-thiophen-2-yl-1,2-oxazol-3-amine.
| Compound Name | 5-[2-(2-methylphenyl)ethyl]-4-thiophen-2-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66199378 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 5-[2-(2-methylphenyl)ethyl]-4-thiophen-2-yl-1,2-oxazol-3-amine |
| SMILES | Cc1ccccc1CCc1onc(N)c1-c1cccs1 |
| InChI | InChI=1S/C16H16N2OS/c1-11-5-2-3-6-12(11)8-9-13-15(16(17)18-19-13)14-7-4-10-20-14/h2-7,10H,8-9H2,1H3,(H2,17,18) |
| InChIKey | GMEVALGVJAWEJD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |