C10H9FN2O — CID 117282839
3-[3-(fluoromethyl)phenyl]-1,2-oxazol-5-amine (PubChem CID 117282839) has the molecular formula C10H9FN2O and a molecular weight of 192.19 g/mol. Its IUPAC name is 3-[3-(fluoromethyl)phenyl]-1,2-oxazol-5-amine.
| Compound Name | 3-[3-(fluoromethyl)phenyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117282839 |
| Molecular Formula | C10H9FN2O |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 3-[3-(fluoromethyl)phenyl]-1,2-oxazol-5-amine |
| SMILES | Nc1cc(-c2cccc(CF)c2)no1 |
| InChI | InChI=1S/C10H9FN2O/c11-6-7-2-1-3-8(4-7)9-5-10(12)14-13-9/h1-5H,6,12H2 |
| InChIKey | PDGQJLRCKWZJGT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |