C13H16N2O — CID 5100398
3-(4-butan-2-ylphenyl)-1,2-oxazol-5-amine (PubChem CID 5100398) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-(4-butan-2-ylphenyl)-1,2-oxazol-5-amine.
| Compound Name | 3-(4-butan-2-ylphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 5100398 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 3-(4-butan-2-ylphenyl)-1,2-oxazol-5-amine |
| SMILES | CCC(C)c1ccc(-c2cc(N)on2)cc1 |
| InChI | InChI=1S/C13H16N2O/c1-3-9(2)10-4-6-11(7-5-10)12-8-13(14)16-15-12/h4-9H,3,14H2,1-2H3 |
| InChIKey | KVLKXSSUBCIHAV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |