C33H39N3 — CID 58250690
2,4,6-tris(4-butan-2-ylphenyl)-1,3,5-triazine (PubChem CID 58250690) has the molecular formula C33H39N3 and a molecular weight of 477.70 g/mol. Its IUPAC name is 2,4,6-tris(4-butan-2-ylphenyl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(4-butan-2-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58250690 |
| Molecular Formula | C33H39N3 |
| Molecular Weight | 477.70 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | 2,4,6-tris(4-butan-2-ylphenyl)-1,3,5-triazine |
| SMILES | CCC(C)c1ccc(-c2nc(-c3ccc(C(C)CC)cc3)nc(-c3ccc(C(C)CC)cc3)n2)cc1 |
| InChI | InChI=1S/C33H39N3/c1-7-22(4)25-10-16-28(17-11-25)31-34-32(29-18-12-26(13-19-29)23(5)8-2)36-33(35-31)30-20-14-27(15-21-30)24(6)9-3/h10-24H,7-9H2,1-6H3 |
| InChIKey | YXNCKUSWYCGCKY-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.70 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |