C51H51N3 — CID 58250718
2,4,6-tris[4-(4-butan-2-ylphenyl)phenyl]-1,3,5-triazine (PubChem CID 58250718) has the molecular formula C51H51N3 and a molecular weight of 705.99 g/mol. Its IUPAC name is 2,4,6-tris[4-(4-butan-2-ylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[4-(4-butan-2-ylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 58250718 |
| Molecular Formula | C51H51N3 |
| Molecular Weight | 705.99 g/mol |
| Exact Mass | 705.41 |
| IUPAC Name | 2,4,6-tris[4-(4-butan-2-ylphenyl)phenyl]-1,3,5-triazine |
| SMILES | CCC(C)c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccc(C(C)CC)cc5)cc4)nc(-c4ccc(-c5ccc(C(C)CC)cc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C51H51N3/c1-7-34(4)37-10-16-40(17-11-37)43-22-28-46(29-23-43)49-52-50(47-30-24-44(25-31-47)41-18-12-38(13-19-41)35(5)8-2)54-51(53-49)48-32-26-45(27-33-48)42-20-14-39(15-21-42)36(6)9-3/h10-36H,7-9H2,1-6H3 |
| InChIKey | DUJNIGNDYRXFBN-UHFFFAOYSA-N |
| XLogP | 14.41 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.99 |
| LogP ≤ 5 | 14.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |