C12H8F6N2O — CID 117494983
3-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]-1,2-oxazol-5-amine (PubChem CID 117494983) has the molecular formula C12H8F6N2O and a molecular weight of 310.20 g/mol. Its IUPAC name is 3-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]-1,2-oxazol-5-amine.
| Compound Name | 3-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117494983 |
| Molecular Formula | C12H8F6N2O |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 3-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]-1,2-oxazol-5-amine |
| SMILES | Nc1cc(-c2ccc(C(C(F)(F)F)C(F)(F)F)cc2)no1 |
| InChI | InChI=1S/C12H8F6N2O/c13-11(14,15)10(12(16,17)18)7-3-1-6(2-4-7)8-5-9(19)21-20-8/h1-5,10H,19H2 |
| InChIKey | ALTILCJFYCRCCO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |