C10H4F3N3S2 — CID 106776757
5-[4-sulfanylidene-2-(trifluoromethyl)-1H-pyrimidin-6-yl]thiophene-2-carbonitrile (PubChem CID 106776757) has the molecular formula C10H4F3N3S2 and a molecular weight of 287.29 g/mol. Its IUPAC name is 5-[4-sulfanylidene-2-(trifluoromethyl)-1H-pyrimidin-6-yl]thiophene-2-carbonitrile.
| Compound Name | 5-[4-sulfanylidene-2-(trifluoromethyl)-1H-pyrimidin-6-yl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 106776757 |
| Molecular Formula | C10H4F3N3S2 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | 5-[4-sulfanylidene-2-(trifluoromethyl)-1H-pyrimidin-6-yl]thiophene-2-carbonitrile |
| SMILES | N#Cc1ccc(-c2cc(=S)nc(C(F)(F)F)[nH]2)s1 |
| InChI | InChI=1S/C10H4F3N3S2/c11-10(12,13)9-15-6(3-8(17)16-9)7-2-1-5(4-14)18-7/h1-3H,(H,15,16,17) |
| InChIKey | BBBQMNAGRJAHCH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|