C12H10F2N2OS2 — CID 106515020
6-[4-(difluoromethylsulfanyl)phenyl]-5-methoxy-1H-pyrimidine-4-thione (PubChem CID 106515020) has the molecular formula C12H10F2N2OS2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 6-[4-(difluoromethylsulfanyl)phenyl]-5-methoxy-1H-pyrimidine-4-thione.
| Compound Name | 6-[4-(difluoromethylsulfanyl)phenyl]-5-methoxy-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106515020 |
| Molecular Formula | C12H10F2N2OS2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 6-[4-(difluoromethylsulfanyl)phenyl]-5-methoxy-1H-pyrimidine-4-thione |
| SMILES | COc1c(-c2ccc(SC(F)F)cc2)[nH]cnc1=S |
| InChI | InChI=1S/C12H10F2N2OS2/c1-17-10-9(15-6-16-11(10)18)7-2-4-8(5-3-7)19-12(13)14/h2-6,12H,1H3,(H,15,16,18) |
| InChIKey | RHWPVHZAFKYKAC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|