C13H11F3N2S — CID 106514616
5-ethyl-6-[4-(trifluoromethyl)phenyl]-1H-pyrimidine-4-thione (PubChem CID 106514616) has the molecular formula C13H11F3N2S and a molecular weight of 284.31 g/mol. Its IUPAC name is 5-ethyl-6-[4-(trifluoromethyl)phenyl]-1H-pyrimidine-4-thione.
| Compound Name | 5-ethyl-6-[4-(trifluoromethyl)phenyl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106514616 |
| Molecular Formula | C13H11F3N2S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 5-ethyl-6-[4-(trifluoromethyl)phenyl]-1H-pyrimidine-4-thione |
| SMILES | CCc1c(-c2ccc(C(F)(F)F)cc2)[nH]cnc1=S |
| InChI | InChI=1S/C13H11F3N2S/c1-2-10-11(17-7-18-12(10)19)8-3-5-9(6-4-8)13(14,15)16/h3-7H,2H2,1H3,(H,17,18,19) |
| InChIKey | FGUUYNVNHKXJML-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|