C64H60F12N4+4 — CID 139142126
2,3,7,8,12,13,17,18-octaethyl-5,10,15,20-tetrakis[4-(trifluoromethyl)phenyl]-21,22,23,24-tetrahydroporphyrin-5,10,15,20-tetraylium (PubChem CID 139142126) has the molecular formula C64H60F12N4+4 and a molecular weight of 1113.19 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octaethyl-5,10,15,20-tetrakis[4-(trifluoromethyl)phenyl]-21,22,23,24-tetrahydroporphyrin-5,10,15,20-tetraylium.
| Compound Name | 2,3,7,8,12,13,17,18-octaethyl-5,10,15,20-tetrakis[4-(trifluoromethyl)phenyl]-21,22,23,24-tetrahydroporphyrin-5,10,15,20-tetraylium |
|---|---|
| PubChem CID | 139142126 |
| Molecular Formula | C64H60F12N4+4 |
| Molecular Weight | 1113.19 g/mol |
| Exact Mass | 1112.46 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octaethyl-5,10,15,20-tetrakis[4-(trifluoromethyl)phenyl]-21,22,23,24-tetrahydroporphyrin-5,10,15,20-tetraylium |
| SMILES | CCc1c2[nH]c(c1CC)[C+](c1ccc(C(F)(F)F)cc1)c1[nH]c(c(CC)c1CC)[C+](c1ccc(C(F)(F)F)cc1)c1[nH]c(c(CC)c1CC)[C+](c1ccc(C(F)(F)F)cc1)c1[nH]c(c(CC)c1CC)[C+]2c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C64H60F12N4/c1-9-41-42(10-2)54-50(34-19-27-38(28-20-34)62(68,69)70)56-45(13-5)46(14-6)58(79-56)52(36-23-31-40(32-24-36)64(74,75)76)60-48(16-8)47(15-7)59(80-60)51(35-21-29-39(30-22-35)63(71,72)73)57-44(12-4)43(11-3)55(78-57)49(53(41)77-54)33-17-25-37(26-18-33)61(65,66)67/h17-32,77-80H,9-16H2,1-8H3/q+4 |
| InChIKey | WIRWHTOPGWLLQI-UHFFFAOYSA-N |
| XLogP | 17.96 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1113.19 |
| LogP ≤ 5 | 17.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|