C12H6Cl3F3N2 — CID 119002817
4-(2,3,5-trichlorophenyl)-6-(trifluoromethyl)pyridin-2-amine (PubChem CID 119002817) has the molecular formula C12H6Cl3F3N2 and a molecular weight of 341.55 g/mol. Its IUPAC name is 4-(2,3,5-trichlorophenyl)-6-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 4-(2,3,5-trichlorophenyl)-6-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 119002817 |
| Molecular Formula | C12H6Cl3F3N2 |
| Molecular Weight | 341.55 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | 4-(2,3,5-trichlorophenyl)-6-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1cc(-c2cc(Cl)cc(Cl)c2Cl)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H6Cl3F3N2/c13-6-3-7(11(15)8(14)4-6)5-1-9(12(16,17)18)20-10(19)2-5/h1-4H,(H2,19,20) |
| InChIKey | IUNFMSYKIKBXIH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|