C11H9F6NO2 — CID 171030486
ethyl 2-[4,6-bis(trifluoromethyl)-2-pyridinyl]acetate (PubChem CID 171030486) has the molecular formula C11H9F6NO2 and a molecular weight of 301.19 g/mol. Its IUPAC name is ethyl 2-[4,6-bis(trifluoromethyl)-2-pyridinyl]acetate.
| Compound Name | ethyl 2-[4,6-bis(trifluoromethyl)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 171030486 |
| Molecular Formula | C11H9F6NO2 |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | ethyl 2-[4,6-bis(trifluoromethyl)-2-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cc(C(F)(F)F)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H9F6NO2/c1-2-20-9(19)5-7-3-6(10(12,13)14)4-8(18-7)11(15,16)17/h3-4H,2,5H2,1H3 |
| InChIKey | ONVLITUGQAEEQI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |