2-(4,6-dimethoxypyrimidin-2-yl)-4-methylpentanoic acid

C12H18N2O4 — CID 113428058

IUPAC2-(4,6-dimethoxypyrimidin-2-yl)-4-methylpentanoic acid
SMILESCOc1cc(OC)nc(C(CC(C)C)C(=O)O)n1
InChIInChI=1S/C12H18N2O4/c1-7(2)5-8(12(15)16)11-13-9(17-3)6-10(14-11)18-4/h6-8H,5H2,1-4H3,(H,15,16)
InChIKeyKSOQETQFMIJDNP-UHFFFAOYSA-N
MW254.29 g/mol
LogP1.71
Rot. Bonds6

About 2-(4,6-dimethoxypyrimidin-2-yl)-4-methylpentanoic acid

2-(4,6-dimethoxypyrimidin-2-yl)-4-methylpentanoic acid (PubChem CID 113428058) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(4,6-dimethoxypyrimidin-2-yl)-4-methylpentanoic acid.

Molecular Properties

Compound Name2-(4,6-dimethoxypyrimidin-2-yl)-4-methylpentanoic acid
PubChem CID113428058
Molecular FormulaC12H18N2O4
Molecular Weight254.29 g/mol
Exact Mass254.13
IUPAC Name2-(4,6-dimethoxypyrimidin-2-yl)-4-methylpentanoic acid
SMILESCOc1cc(OC)nc(C(CC(C)C)C(=O)O)n1
InChIInChI=1S/C12H18N2O4/c1-7(2)5-8(12(15)16)11-13-9(17-3)6-10(14-11)18-4/h6-8H,5H2,1-4H3,(H,15,16)
InChIKeyKSOQETQFMIJDNP-UHFFFAOYSA-N
XLogP1.71
TPSA81.54 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.29
LogP ≤ 51.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(4,6-dimethoxypyrimidin-2-yl)-4-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,6-dimethoxypyrimidin-2-yl)-4-methylpentanoic acid?
The IUPAC name of 2-(4,6-dimethoxypyrimidin-2-yl)-4-methylpentanoic acid (CID 113428058) is 2-(4,6-dimethoxypyrimidin-2-yl)-4-methylpentanoic acid.
What is the SMILES notation for 2-(4,6-dimethoxypyrimidin-2-yl)-4-methylpentanoic acid?
The canonical SMILES for 2-(4,6-dimethoxypyrimidin-2-yl)-4-methylpentanoic acid is COc1cc(OC)nc(C(CC(C)C)C(=O)O)n1.
What is the InChIKey of 2-(4,6-dimethoxypyrimidin-2-yl)-4-methylpentanoic acid?
The InChIKey is KSOQETQFMIJDNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O4/c1-7(2)5-8(12(15)16)11-13-9(17-3)6-10(14-11)18-4/h6-8H,5H2,1-4H3,(H,15,16).
What are the key properties of 2-(4,6-dimethoxypyrimidin-2-yl)-4-methylpentanoic acid?
2-(4,6-dimethoxypyrimidin-2-yl)-4-methylpentanoic acid has a molecular weight of 254.29 g/mol, XLogP of 1.71, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethoxypyrimidin-2-yl)-4-methylpentanoic acid is sourced from PubChem (CID 113428058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).