C10H14N2O4 — CID 105483713
3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid (PubChem CID 105483713) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid.
| Compound Name | 3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 105483713 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid |
| SMILES | COc1cc(OC)nc(CC(C)C(=O)O)n1 |
| InChI | InChI=1S/C10H14N2O4/c1-6(10(13)14)4-7-11-8(15-2)5-9(12-7)16-3/h5-6H,4H2,1-3H3,(H,13,14) |
| InChIKey | FFCNUFIDGVYUKO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |