3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid

C10H14N2O4 — CID 105483713

IUPAC3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid
SMILESCOc1cc(OC)nc(CC(C)C(=O)O)n1
InChIInChI=1S/C10H14N2O4/c1-6(10(13)14)4-7-11-8(15-2)5-9(12-7)16-3/h5-6H,4H2,1-3H3,(H,13,14)
InChIKeyFFCNUFIDGVYUKO-UHFFFAOYSA-N
MW226.23 g/mol
LogP0.76
Rot. Bonds5

About 3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid

3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid (PubChem CID 105483713) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid.

Molecular Properties

Compound Name3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid
PubChem CID105483713
Molecular FormulaC10H14N2O4
Molecular Weight226.23 g/mol
Exact Mass226.10
IUPAC Name3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid
SMILESCOc1cc(OC)nc(CC(C)C(=O)O)n1
InChIInChI=1S/C10H14N2O4/c1-6(10(13)14)4-7-11-8(15-2)5-9(12-7)16-3/h5-6H,4H2,1-3H3,(H,13,14)
InChIKeyFFCNUFIDGVYUKO-UHFFFAOYSA-N
XLogP0.76
TPSA81.54 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.23
LogP ≤ 50.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid?
The IUPAC name of 3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid (CID 105483713) is 3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid.
What is the SMILES notation for 3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid?
The canonical SMILES for 3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid is COc1cc(OC)nc(CC(C)C(=O)O)n1.
What is the InChIKey of 3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid?
The InChIKey is FFCNUFIDGVYUKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O4/c1-6(10(13)14)4-7-11-8(15-2)5-9(12-7)16-3/h5-6H,4H2,1-3H3,(H,13,14).
What are the key properties of 3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid?
3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid has a molecular weight of 226.23 g/mol, XLogP of 0.76, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,6-dimethoxypyrimidin-2-yl)-2-methylpropanoic acid is sourced from PubChem (CID 105483713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).