C11H16N2O3 — CID 115355584
1-(4,6-dimethoxypyrimidin-2-yl)pentan-2-one (PubChem CID 115355584) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-2-yl)pentan-2-one.
| Compound Name | 1-(4,6-dimethoxypyrimidin-2-yl)pentan-2-one |
|---|---|
| PubChem CID | 115355584 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-2-yl)pentan-2-one |
| SMILES | CCCC(=O)Cc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C11H16N2O3/c1-4-5-8(14)6-9-12-10(15-2)7-11(13-9)16-3/h7H,4-6H2,1-3H3 |
| InChIKey | CGJJVRSIPBNKJC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |