C12H21N3O2 — CID 115355620
1-(4,6-dimethoxypyrimidin-2-yl)-N-methylpentan-2-amine (PubChem CID 115355620) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-2-yl)-N-methylpentan-2-amine.
| Compound Name | 1-(4,6-dimethoxypyrimidin-2-yl)-N-methylpentan-2-amine |
|---|---|
| PubChem CID | 115355620 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-2-yl)-N-methylpentan-2-amine |
| SMILES | CCCC(Cc1nc(OC)cc(OC)n1)NC |
| InChI | InChI=1S/C12H21N3O2/c1-5-6-9(13-2)7-10-14-11(16-3)8-12(15-10)17-4/h8-9,13H,5-7H2,1-4H3 |
| InChIKey | CSATUYACXIANOA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |