C11H15BrN2O2 — CID 115355679
2-(2-bromo-2-cyclopropylethyl)-4,6-dimethoxypyrimidine (PubChem CID 115355679) has the molecular formula C11H15BrN2O2 and a molecular weight of 287.16 g/mol. Its IUPAC name is 2-(2-bromo-2-cyclopropylethyl)-4,6-dimethoxypyrimidine.
| Compound Name | 2-(2-bromo-2-cyclopropylethyl)-4,6-dimethoxypyrimidine |
|---|---|
| PubChem CID | 115355679 |
| Molecular Formula | C11H15BrN2O2 |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 2-(2-bromo-2-cyclopropylethyl)-4,6-dimethoxypyrimidine |
| SMILES | COc1cc(OC)nc(CC(Br)C2CC2)n1 |
| InChI | InChI=1S/C11H15BrN2O2/c1-15-10-6-11(16-2)14-9(13-10)5-8(12)7-3-4-7/h6-8H,3-5H2,1-2H3 |
| InChIKey | ASWXKLPBBNMAPS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|