C13H12Cl2FN3O2 — CID 67349968
3-chloro-2-[chloro-(4,6-dimethoxypyrimidin-2-yl)methyl]-6-fluoroaniline (PubChem CID 67349968) has the molecular formula C13H12Cl2FN3O2 and a molecular weight of 332.16 g/mol. Its IUPAC name is 3-chloro-2-[chloro-(4,6-dimethoxypyrimidin-2-yl)methyl]-6-fluoroaniline.
| Compound Name | 3-chloro-2-[chloro-(4,6-dimethoxypyrimidin-2-yl)methyl]-6-fluoroaniline |
|---|---|
| PubChem CID | 67349968 |
| Molecular Formula | C13H12Cl2FN3O2 |
| Molecular Weight | 332.16 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 3-chloro-2-[chloro-(4,6-dimethoxypyrimidin-2-yl)methyl]-6-fluoroaniline |
| SMILES | COc1cc(OC)nc(C(Cl)c2c(Cl)ccc(F)c2N)n1 |
| InChI | InChI=1S/C13H12Cl2FN3O2/c1-20-8-5-9(21-2)19-13(18-8)11(15)10-6(14)3-4-7(16)12(10)17/h3-5,11H,17H2,1-2H3 |
| InChIKey | UNIMBTCLSGTDDK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.16 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|