About 3-butyl-2-nitrobenzoic acid
3-butyl-2-nitrobenzoic acid (PubChem CID 68623625) has the molecular formula C11H13NO4
and a molecular weight of 223.23 g/mol. Its IUPAC name is 3-butyl-2-nitrobenzoic acid.
Molecular Properties
| Compound Name | 3-butyl-2-nitrobenzoic acid |
| PubChem CID | 68623625 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 3-butyl-2-nitrobenzoic acid |
| SMILES | CCCCc1cccc(C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13NO4/c1-2-3-5-8-6-4-7-9(11(13)14)10(8)12(15)16/h4,6-7H,2-3,5H2,1H3,(H,13,14) |
| InChIKey | VUTYWNIXEOKNDH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-2-nitrobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-2-nitrobenzoic acid?
The IUPAC name of 3-butyl-2-nitrobenzoic acid (CID 68623625) is 3-butyl-2-nitrobenzoic acid.
What is the SMILES notation for 3-butyl-2-nitrobenzoic acid?
The canonical SMILES for 3-butyl-2-nitrobenzoic acid is CCCCc1cccc(C(=O)O)c1[N+](=O)[O-].
What is the InChIKey of 3-butyl-2-nitrobenzoic acid?
The InChIKey is VUTYWNIXEOKNDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4/c1-2-3-5-8-6-4-7-9(11(13)14)10(8)12(15)16/h4,6-7H,2-3,5H2,1H3,(H,13,14).
What are the key properties of 3-butyl-2-nitrobenzoic acid?
3-butyl-2-nitrobenzoic acid has a molecular weight of 223.23 g/mol, XLogP of 2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-2-nitrobenzoic acid is sourced from PubChem (CID 68623625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).