C17H22N4O3 — CID 69237209
4-N-[(2-ethyl-6-methylphenyl)methyl]-6-methoxy-2-N-methyl-3-nitropyridine-2,4-diamine (PubChem CID 69237209) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 4-N-[(2-ethyl-6-methylphenyl)methyl]-6-methoxy-2-N-methyl-3-nitropyridine-2,4-diamine.
| Compound Name | 4-N-[(2-ethyl-6-methylphenyl)methyl]-6-methoxy-2-N-methyl-3-nitropyridine-2,4-diamine |
|---|---|
| PubChem CID | 69237209 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 4-N-[(2-ethyl-6-methylphenyl)methyl]-6-methoxy-2-N-methyl-3-nitropyridine-2,4-diamine |
| SMILES | CCc1cccc(C)c1CNc1cc(OC)nc(NC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22N4O3/c1-5-12-8-6-7-11(2)13(12)10-19-14-9-15(24-4)20-17(18-3)16(14)21(22)23/h6-9H,5,10H2,1-4H3,(H2,18,19,20) |
| InChIKey | CWKBWEDOHMRTCI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|