C18H21ClN4 — CID 86620286
5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine (PubChem CID 86620286) has the molecular formula C18H21ClN4 and a molecular weight of 328.85 g/mol. Its IUPAC name is 5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine.
| Compound Name | 5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 86620286 |
| Molecular Formula | C18H21ClN4 |
| Molecular Weight | 328.85 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine |
| SMILES | CCc1cccc(C)c1CNc1cc(Cl)nc2c1nc(C)n2C |
| InChI | InChI=1S/C18H21ClN4/c1-5-13-8-6-7-11(2)14(13)10-20-15-9-16(19)22-18-17(15)21-12(3)23(18)4/h6-9H,5,10H2,1-4H3,(H,20,22) |
| InChIKey | XLXFDWRWUAEUPV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|