About 5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine
5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine (PubChem CID 86620286) has the molecular formula C18H21ClN4
and a molecular weight of 328.85 g/mol. Its IUPAC name is 5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine.
Molecular Properties
| Compound Name | 5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine |
| PubChem CID | 86620286 |
| Molecular Formula | C18H21ClN4 |
| Molecular Weight | 328.85 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine |
| SMILES | CCc1cccc(C)c1CNc1cc(Cl)nc2c1nc(C)n2C |
| InChI | InChI=1S/C18H21ClN4/c1-5-13-8-6-7-11(2)14(13)10-20-15-9-16(19)22-18-17(15)21-12(3)23(18)4/h6-9H,5,10H2,1-4H3,(H,20,22) |
| InChIKey | XLXFDWRWUAEUPV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine?
The IUPAC name of 5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine (CID 86620286) is 5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine.
What is the SMILES notation for 5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine?
The canonical SMILES for 5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine is CCc1cccc(C)c1CNc1cc(Cl)nc2c1nc(C)n2C.
What is the InChIKey of 5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine?
The InChIKey is XLXFDWRWUAEUPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21ClN4/c1-5-13-8-6-7-11(2)14(13)10-20-15-9-16(19)22-18-17(15)21-12(3)23(18)4/h6-9H,5,10H2,1-4H3,(H,20,22).
What are the key properties of 5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine?
5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine has a molecular weight of 328.85 g/mol, XLogP of 4.41, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[(2-ethyl-6-methylphenyl)methyl]-2,3-dimethylimidazo[4,5-b]pyridin-7-amine is sourced from PubChem (CID 86620286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).