C13H14ClN3O4 — CID 139146085
2-chlorobenzoic acid;4,6-dimethoxypyrimidin-2-amine (PubChem CID 139146085) has the molecular formula C13H14ClN3O4 and a molecular weight of 311.73 g/mol. Its IUPAC name is 2-chlorobenzoic acid;4,6-dimethoxypyrimidin-2-amine.
| Compound Name | 2-chlorobenzoic acid;4,6-dimethoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 139146085 |
| Molecular Formula | C13H14ClN3O4 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-chlorobenzoic acid;4,6-dimethoxypyrimidin-2-amine |
| SMILES | COc1cc(OC)nc(N)n1.O=C(O)c1ccccc1Cl |
| InChI | InChI=1S/C7H5ClO2.C6H9N3O2/c8-6-4-2-1-3-5(6)7(9)10;1-10-4-3-5(11-2)9-6(7)8-4/h1-4H,(H,9,10);3H,1-2H3,(H2,7,8,9) |
| InChIKey | CUNKAXOZFQWHAJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |