About 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid
2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid (PubChem CID 69231966) has the molecular formula C26H22Cl2N4O8S2
and a molecular weight of 653.52 g/mol. Its IUPAC name is 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid.
Molecular Properties
| Compound Name | 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid |
| PubChem CID | 69231966 |
| Molecular Formula | C26H22Cl2N4O8S2 |
| Molecular Weight | 653.52 g/mol |
| Exact Mass | 652.03 |
| IUPAC Name | 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid |
| SMILES | COc1cc(OC)nc(Sc2cccc(Cl)c2C(=O)O)n1.COc1cc(OC)nc(Sc2cccc(Cl)c2C(=O)O)n1 |
| InChI | InChI=1S/2C13H11ClN2O4S/c2*1-19-9-6-10(20-2)16-13(15-9)21-8-5-3-4-7(14)11(8)12(17)18/h2*3-6H,1-2H3,(H,17,18) |
| InChIKey | BLCRFNONNRAGFR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 163.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 653.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
Analyze 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid?
The IUPAC name of 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid (CID 69231966) is 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid.
What is the SMILES notation for 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid?
The canonical SMILES for 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid is COc1cc(OC)nc(Sc2cccc(Cl)c2C(=O)O)n1.COc1cc(OC)nc(Sc2cccc(Cl)c2C(=O)O)n1.
What is the InChIKey of 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid?
The InChIKey is BLCRFNONNRAGFR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H11ClN2O4S/c2*1-19-9-6-10(20-2)16-13(15-9)21-8-5-3-4-7(14)11(8)12(17)18/h2*3-6H,1-2H3,(H,17,18).
What are the key properties of 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid?
2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid has a molecular weight of 653.52 g/mol, XLogP of 5.99, 10 rotatable bonds, 2 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid is sourced from PubChem (CID 69231966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).