C13H11ClN2O4S — CID 14601113
5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid (PubChem CID 14601113) has the molecular formula C13H11ClN2O4S and a molecular weight of 326.76 g/mol. Its IUPAC name is 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid.
| Compound Name | 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid |
|---|---|
| PubChem CID | 14601113 |
| Molecular Formula | C13H11ClN2O4S |
| Molecular Weight | 326.76 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid |
| SMILES | COc1cc(OC)nc(Sc2ccc(Cl)cc2C(=O)O)n1 |
| InChI | InChI=1S/C13H11ClN2O4S/c1-19-10-6-11(20-2)16-13(15-10)21-9-4-3-7(14)5-8(9)12(17)18/h3-6H,1-2H3,(H,17,18) |
| InChIKey | VYTLPOJAYMWZKT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.76 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |