methyl 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoate

C14H13ClN2O5 — CID 1214892

IUPACmethyl 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoate
SMILESCOC(=O)c1cc(Cl)ccc1Oc1nc(OC)cc(OC)n1
InChIInChI=1S/C14H13ClN2O5/c1-19-11-7-12(20-2)17-14(16-11)22-10-5-4-8(15)6-9(10)13(18)21-3/h4-7H,1-3H3
InChIKeyPHHKBDWTWIQZFB-UHFFFAOYSA-N
MW324.72 g/mol
LogP2.73
Rot. Bonds5

About methyl 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoate

methyl 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoate (PubChem CID 1214892) has the molecular formula C14H13ClN2O5 and a molecular weight of 324.72 g/mol. Its IUPAC name is methyl 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoate.

Molecular Properties

Compound Namemethyl 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoate
PubChem CID1214892
Molecular FormulaC14H13ClN2O5
Molecular Weight324.72 g/mol
Exact Mass324.05
IUPAC Namemethyl 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoate
SMILESCOC(=O)c1cc(Cl)ccc1Oc1nc(OC)cc(OC)n1
InChIInChI=1S/C14H13ClN2O5/c1-19-11-7-12(20-2)17-14(16-11)22-10-5-4-8(15)6-9(10)13(18)21-3/h4-7H,1-3H3
InChIKeyPHHKBDWTWIQZFB-UHFFFAOYSA-N
XLogP2.73
TPSA79.77 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500324.72
LogP ≤ 52.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze methyl 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoate?
The IUPAC name of methyl 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoate (CID 1214892) is methyl 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoate.
What is the SMILES notation for methyl 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoate?
The canonical SMILES for methyl 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoate is COC(=O)c1cc(Cl)ccc1Oc1nc(OC)cc(OC)n1.
What is the InChIKey of methyl 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoate?
The InChIKey is PHHKBDWTWIQZFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN2O5/c1-19-11-7-12(20-2)17-14(16-11)22-10-5-4-8(15)6-9(10)13(18)21-3/h4-7H,1-3H3.
What are the key properties of methyl 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoate?
methyl 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoate has a molecular weight of 324.72 g/mol, XLogP of 2.73, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-chloro-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoate is sourced from PubChem (CID 1214892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).