About potassium 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate
potassium 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate (PubChem CID 165360477) has the molecular formula C13H10ClKN2O4S
and a molecular weight of 364.85 g/mol. Its IUPAC name is potassium 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate.
Molecular Properties
| Compound Name | potassium 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate |
| PubChem CID | 165360477 |
| Molecular Formula | C13H10ClKN2O4S |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | potassium 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate |
| SMILES | COc1cc(OC)nc(Sc2cccc(Cl)c2C(=O)[O-])n1.[K+] |
| InChI | InChI=1S/C13H11ClN2O4S.K/c1-19-9-6-10(20-2)16-13(15-9)21-8-5-3-4-7(14)11(8)12(17)18;/h3-6H,1-2H3,(H,17,18);/q;+1/p-1 |
| InChIKey | KWNSTEUXFOEPSS-UHFFFAOYSA-M |
| XLogP | -1.33 |
| TPSA | 84.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze potassium 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate?
The IUPAC name of potassium 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate (CID 165360477) is potassium 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate.
What is the SMILES notation for potassium 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate?
The canonical SMILES for potassium 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate is COc1cc(OC)nc(Sc2cccc(Cl)c2C(=O)[O-])n1.[K+].
What is the InChIKey of potassium 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate?
The InChIKey is KWNSTEUXFOEPSS-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H11ClN2O4S.K/c1-19-9-6-10(20-2)16-13(15-9)21-8-5-3-4-7(14)11(8)12(17)18;/h3-6H,1-2H3,(H,17,18);/q;+1/p-1.
What are the key properties of potassium 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate?
potassium 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate has a molecular weight of 364.85 g/mol, XLogP of -1.33, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate is sourced from PubChem (CID 165360477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).