C23H43NO3S — CID 143716658
3-methyl-N-methylsulfonylbenzamide;nonane;pentane (PubChem CID 143716658) has the molecular formula C23H43NO3S and a molecular weight of 413.67 g/mol. Its IUPAC name is 3-methyl-N-methylsulfonylbenzamide;nonane;pentane.
| Compound Name | 3-methyl-N-methylsulfonylbenzamide;nonane;pentane |
|---|---|
| PubChem CID | 143716658 |
| Molecular Formula | C23H43NO3S |
| Molecular Weight | 413.67 g/mol |
| Exact Mass | 413.30 |
| IUPAC Name | 3-methyl-N-methylsulfonylbenzamide;nonane;pentane |
| SMILES | CCCCC.CCCCCCCCC.Cc1cccc(C(=O)NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C9H11NO3S.C9H20.C5H12/c1-7-4-3-5-8(6-7)9(11)10-14(2,12)13;1-3-5-7-9-8-6-4-2;1-3-5-4-2/h3-6H,1-2H3,(H,10,11);3-9H2,1-2H3;3-5H2,1-2H3 |
| InChIKey | CPRVOYGCVFWVHP-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.67 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|