C18H15F5N2O2 — CID 23276915
N'-benzoyl-N-tert-butyl-2,3,4,5,6-pentafluorobenzohydrazide (PubChem CID 23276915) has the molecular formula C18H15F5N2O2 and a molecular weight of 386.32 g/mol. Its IUPAC name is N'-benzoyl-N-tert-butyl-2,3,4,5,6-pentafluorobenzohydrazide.
| Compound Name | N'-benzoyl-N-tert-butyl-2,3,4,5,6-pentafluorobenzohydrazide |
|---|---|
| PubChem CID | 23276915 |
| Molecular Formula | C18H15F5N2O2 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N'-benzoyl-N-tert-butyl-2,3,4,5,6-pentafluorobenzohydrazide |
| SMILES | CC(C)(C)N(NC(=O)c1ccccc1)C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H15F5N2O2/c1-18(2,3)25(24-16(26)9-7-5-4-6-8-9)17(27)10-11(19)13(21)15(23)14(22)12(10)20/h4-8H,1-3H3,(H,24,26) |
| InChIKey | SZANKBFLRHSJDT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|