C24H20F5N3O2 — CID 23164374
N'-(4-anilinobenzoyl)-N-tert-butyl-2,3,4,5,6-pentafluorobenzohydrazide (PubChem CID 23164374) has the molecular formula C24H20F5N3O2 and a molecular weight of 477.43 g/mol. Its IUPAC name is N'-(4-anilinobenzoyl)-N-tert-butyl-2,3,4,5,6-pentafluorobenzohydrazide.
| Compound Name | N'-(4-anilinobenzoyl)-N-tert-butyl-2,3,4,5,6-pentafluorobenzohydrazide |
|---|---|
| PubChem CID | 23164374 |
| Molecular Formula | C24H20F5N3O2 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | N'-(4-anilinobenzoyl)-N-tert-butyl-2,3,4,5,6-pentafluorobenzohydrazide |
| SMILES | CC(C)(C)N(NC(=O)c1ccc(Nc2ccccc2)cc1)C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H20F5N3O2/c1-24(2,3)32(23(34)16-17(25)19(27)21(29)20(28)18(16)26)31-22(33)13-9-11-15(12-10-13)30-14-7-5-4-6-8-14/h4-12,30H,1-3H3,(H,31,33) |
| InChIKey | QTTKUAXNGDTXPV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|