C17H26ClN3O2Si — CID 67940316
(3R)-4-(4-chlorophenyl)-3-methyl-5-(1,2,4-triazol-1-yl)-4-trimethylsilyloxypentan-2-ol (PubChem CID 67940316) has the molecular formula C17H26ClN3O2Si and a molecular weight of 367.95 g/mol. Its IUPAC name is (3R)-4-(4-chlorophenyl)-3-methyl-5-(1,2,4-triazol-1-yl)-4-trimethylsilyloxypentan-2-ol.
| Compound Name | (3R)-4-(4-chlorophenyl)-3-methyl-5-(1,2,4-triazol-1-yl)-4-trimethylsilyloxypentan-2-ol |
|---|---|
| PubChem CID | 67940316 |
| Molecular Formula | C17H26ClN3O2Si |
| Molecular Weight | 367.95 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (3R)-4-(4-chlorophenyl)-3-methyl-5-(1,2,4-triazol-1-yl)-4-trimethylsilyloxypentan-2-ol |
| SMILES | CC(O)[C@@H](C)C(Cn1cncn1)(O[Si](C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H26ClN3O2Si/c1-13(14(2)22)17(23-24(3,4)5,10-21-12-19-11-20-21)15-6-8-16(18)9-7-15/h6-9,11-14,22H,10H2,1-5H3/t13-,14?,17?/m1/s1 |
| InChIKey | LQUROTVABAELQI-TUBUQKNSSA-N |
| XLogP | 3.70 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.95 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|