C32H29F2N3O2 — CID 10744649
(2S,3S)-2-(2,4-difluorophenyl)-3-methyl-1-(1,2,4-triazol-1-yl)-4-trityloxybutan-2-ol (PubChem CID 10744649) has the molecular formula C32H29F2N3O2 and a molecular weight of 525.60 g/mol. Its IUPAC name is (2S,3S)-2-(2,4-difluorophenyl)-3-methyl-1-(1,2,4-triazol-1-yl)-4-trityloxybutan-2-ol.
| Compound Name | (2S,3S)-2-(2,4-difluorophenyl)-3-methyl-1-(1,2,4-triazol-1-yl)-4-trityloxybutan-2-ol |
|---|---|
| PubChem CID | 10744649 |
| Molecular Formula | C32H29F2N3O2 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | (2S,3S)-2-(2,4-difluorophenyl)-3-methyl-1-(1,2,4-triazol-1-yl)-4-trityloxybutan-2-ol |
| SMILES | C[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C32H29F2N3O2/c1-24(31(38,21-37-23-35-22-36-37)29-18-17-28(33)19-30(29)34)20-39-32(25-11-5-2-6-12-25,26-13-7-3-8-14-26)27-15-9-4-10-16-27/h2-19,22-24,38H,20-21H2,1H3/t24-,31-/m0/s1 |
| InChIKey | RYFLPPDHFZWDIZ-DLLPINGYSA-N |
| XLogP | 6.09 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|