C18H22N4O — CID 95341586
2-cyclohexylidene-N-[(1S)-1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]acetamide (PubChem CID 95341586) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-cyclohexylidene-N-[(1S)-1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]acetamide.
| Compound Name | 2-cyclohexylidene-N-[(1S)-1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 95341586 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-cyclohexylidene-N-[(1S)-1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]acetamide |
| SMILES | O=C(C=C1CCCCC1)N[C@H](Cn1cncn1)c1ccccc1 |
| InChI | InChI=1S/C18H22N4O/c23-18(11-15-7-3-1-4-8-15)21-17(12-22-14-19-13-20-22)16-9-5-2-6-10-16/h2,5-6,9-11,13-14,17H,1,3-4,7-8,12H2,(H,21,23)/t17-/m1/s1 |
| InChIKey | JDEHSCMZFVSJLJ-QGZVFWFLSA-N |
| XLogP | 3.03 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|