C15H19N5O3 — CID 167808129
2-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-3-(5-methyl-1H-imidazol-4-yl)propanoic acid (PubChem CID 167808129) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-3-(5-methyl-1H-imidazol-4-yl)propanoic acid.
| Compound Name | 2-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-3-(5-methyl-1H-imidazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 167808129 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 2-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-3-(5-methyl-1H-imidazol-4-yl)propanoic acid |
| SMILES | C#CCCC1(CCC(=O)NC(Cc2nc[nH]c2C)C(=O)O)N=N1 |
| InChI | InChI=1S/C15H19N5O3/c1-3-4-6-15(19-20-15)7-5-13(21)18-12(14(22)23)8-11-10(2)16-9-17-11/h1,9,12H,4-8H2,2H3,(H,16,17)(H,18,21)(H,22,23) |
| InChIKey | BNKQGFVJEAYEHT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|