C15H17N7O3 — CID 167963225
1-[4-[1-[(2-oxoimidazolidine-4-carbonyl)amino]ethyl]phenyl]triazole-4-carboxamide (PubChem CID 167963225) has the molecular formula C15H17N7O3 and a molecular weight of 343.35 g/mol. Its IUPAC name is 1-[4-[1-[(2-oxoimidazolidine-4-carbonyl)amino]ethyl]phenyl]triazole-4-carboxamide.
| Compound Name | 1-[4-[1-[(2-oxoimidazolidine-4-carbonyl)amino]ethyl]phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 167963225 |
| Molecular Formula | C15H17N7O3 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-[4-[1-[(2-oxoimidazolidine-4-carbonyl)amino]ethyl]phenyl]triazole-4-carboxamide |
| SMILES | CC(NC(=O)C1CNC(=O)N1)c1ccc(-n2cc(C(N)=O)nn2)cc1 |
| InChI | InChI=1S/C15H17N7O3/c1-8(18-14(24)11-6-17-15(25)19-11)9-2-4-10(5-3-9)22-7-12(13(16)23)20-21-22/h2-5,7-8,11H,6H2,1H3,(H2,16,23)(H,18,24)(H2,17,19,25) |
| InChIKey | FHWUBZUAYBDSDI-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 144.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |