C22H29N5O2 — CID 166417842
4-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-N-methyl-N-(1-methylpiperidin-3-yl)benzamide (PubChem CID 166417842) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 4-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-N-methyl-N-(1-methylpiperidin-3-yl)benzamide.
| Compound Name | 4-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-N-methyl-N-(1-methylpiperidin-3-yl)benzamide |
|---|---|
| PubChem CID | 166417842 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 4-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-N-methyl-N-(1-methylpiperidin-3-yl)benzamide |
| SMILES | C#CCCC1(CCC(=O)Nc2ccc(C(=O)N(C)C3CCCN(C)C3)cc2)N=N1 |
| InChI | InChI=1S/C22H29N5O2/c1-4-5-13-22(24-25-22)14-12-20(28)23-18-10-8-17(9-11-18)21(29)27(3)19-7-6-15-26(2)16-19/h1,8-11,19H,5-7,12-16H2,2-3H3,(H,23,28) |
| InChIKey | SSGWPDVZQIUFQZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 77.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|