C18H14F3N3O3 — CID 167990514
3-(3-but-3-ynyldiazirin-3-yl)-N-[4-oxo-2-(trifluoromethyl)chromen-6-yl]propanamide (PubChem CID 167990514) has the molecular formula C18H14F3N3O3 and a molecular weight of 377.32 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N-[4-oxo-2-(trifluoromethyl)chromen-6-yl]propanamide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[4-oxo-2-(trifluoromethyl)chromen-6-yl]propanamide |
|---|---|
| PubChem CID | 167990514 |
| Molecular Formula | C18H14F3N3O3 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[4-oxo-2-(trifluoromethyl)chromen-6-yl]propanamide |
| SMILES | C#CCCC1(CCC(=O)Nc2ccc3oc(C(F)(F)F)cc(=O)c3c2)N=N1 |
| InChI | InChI=1S/C18H14F3N3O3/c1-2-3-7-17(23-24-17)8-6-16(26)22-11-4-5-14-12(9-11)13(25)10-15(27-14)18(19,20)21/h1,4-5,9-10H,3,6-8H2,(H,22,26) |
| InChIKey | YMFSMLQCGIHFDY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 84.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|