C15H14FN5O — CID 167867290
3-(3-but-3-ynyldiazirin-3-yl)-N'-(4-cyano-3-fluorophenyl)propanehydrazide (PubChem CID 167867290) has the molecular formula C15H14FN5O and a molecular weight of 299.31 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N'-(4-cyano-3-fluorophenyl)propanehydrazide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N'-(4-cyano-3-fluorophenyl)propanehydrazide |
|---|---|
| PubChem CID | 167867290 |
| Molecular Formula | C15H14FN5O |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N'-(4-cyano-3-fluorophenyl)propanehydrazide |
| SMILES | C#CCCC1(CCC(=O)NNc2ccc(C#N)c(F)c2)N=N1 |
| InChI | InChI=1S/C15H14FN5O/c1-2-3-7-15(20-21-15)8-6-14(22)19-18-12-5-4-11(10-17)13(16)9-12/h1,4-5,9,18H,3,6-8H2,(H,19,22) |
| InChIKey | PDWKLONLSFHUID-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|