C20H26N4O — CID 26224065
(5R)-N-benzyl-N,1-dimethyl-5-(prop-2-enylamino)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 26224065) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is (5R)-N-benzyl-N,1-dimethyl-5-(prop-2-enylamino)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | (5R)-N-benzyl-N,1-dimethyl-5-(prop-2-enylamino)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 26224065 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (5R)-N-benzyl-N,1-dimethyl-5-(prop-2-enylamino)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | C=CCN[C@@H]1CCc2c(c(C(=O)N(C)Cc3ccccc3)nn2C)C1 |
| InChI | InChI=1S/C20H26N4O/c1-4-12-21-16-10-11-18-17(13-16)19(22-24(18)3)20(25)23(2)14-15-8-6-5-7-9-15/h4-9,16,21H,1,10-14H2,2-3H3/t16-/m1/s1 |
| InChIKey | BFXRDANCNWEUAS-MRXNPFEDSA-N |
| XLogP | 2.33 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|