C22H32N4O2 — CID 26143065
(5S)-N-benzyl-5-(3-ethoxypropylamino)-N,1-dimethyl-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 26143065) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is (5S)-N-benzyl-5-(3-ethoxypropylamino)-N,1-dimethyl-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | (5S)-N-benzyl-5-(3-ethoxypropylamino)-N,1-dimethyl-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 26143065 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | (5S)-N-benzyl-5-(3-ethoxypropylamino)-N,1-dimethyl-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CCOCCCN[C@H]1CCc2c(c(C(=O)N(C)Cc3ccccc3)nn2C)C1 |
| InChI | InChI=1S/C22H32N4O2/c1-4-28-14-8-13-23-18-11-12-20-19(15-18)21(24-26(20)3)22(27)25(2)16-17-9-6-5-7-10-17/h5-7,9-10,18,23H,4,8,11-16H2,1-3H3/t18-/m0/s1 |
| InChIKey | BJRMZLCRAKDJIQ-SFHVURJKSA-N |
| XLogP | 2.57 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|