C19H25NO5S — CID 59487228
propyl 2-(6-methyl-7-methylsulfonyloxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)acetate (PubChem CID 59487228) has the molecular formula C19H25NO5S and a molecular weight of 379.48 g/mol. Its IUPAC name is propyl 2-(6-methyl-7-methylsulfonyloxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)acetate.
| Compound Name | propyl 2-(6-methyl-7-methylsulfonyloxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)acetate |
|---|---|
| PubChem CID | 59487228 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | propyl 2-(6-methyl-7-methylsulfonyloxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)acetate |
| SMILES | CCCOC(=O)Cc1c2n(c3ccccc13)C(C)C(OS(C)(=O)=O)CC2 |
| InChI | InChI=1S/C19H25NO5S/c1-4-11-24-19(21)12-15-14-7-5-6-8-16(14)20-13(2)18(10-9-17(15)20)25-26(3,22)23/h5-8,13,18H,4,9-12H2,1-3H3 |
| InChIKey | LTVZNPUIQKTERL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|