C20H21NO4S2 — CID 69122919
ethyl 2-[2-methyl-1-(4-methylsulfonylphenyl)sulfanylindolizin-3-yl]acetate (PubChem CID 69122919) has the molecular formula C20H21NO4S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is ethyl 2-[2-methyl-1-(4-methylsulfonylphenyl)sulfanylindolizin-3-yl]acetate.
| Compound Name | ethyl 2-[2-methyl-1-(4-methylsulfonylphenyl)sulfanylindolizin-3-yl]acetate |
|---|---|
| PubChem CID | 69122919 |
| Molecular Formula | C20H21NO4S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | ethyl 2-[2-methyl-1-(4-methylsulfonylphenyl)sulfanylindolizin-3-yl]acetate |
| SMILES | CCOC(=O)Cc1c(C)c(Sc2ccc(S(C)(=O)=O)cc2)c2ccccn12 |
| InChI | InChI=1S/C20H21NO4S2/c1-4-25-19(22)13-18-14(2)20(17-7-5-6-12-21(17)18)26-15-8-10-16(11-9-15)27(3,23)24/h5-12H,4,13H2,1-3H3 |
| InChIKey | ICQXFBSQWPQAQA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |