C21H22FNO4S2 — CID 68693353
ethyl 2-[3-(4-ethylsulfonylphenyl)sulfanyl-6-fluoro-2-methylindolizin-1-yl]acetate (PubChem CID 68693353) has the molecular formula C21H22FNO4S2 and a molecular weight of 435.54 g/mol. Its IUPAC name is ethyl 2-[3-(4-ethylsulfonylphenyl)sulfanyl-6-fluoro-2-methylindolizin-1-yl]acetate.
| Compound Name | ethyl 2-[3-(4-ethylsulfonylphenyl)sulfanyl-6-fluoro-2-methylindolizin-1-yl]acetate |
|---|---|
| PubChem CID | 68693353 |
| Molecular Formula | C21H22FNO4S2 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | ethyl 2-[3-(4-ethylsulfonylphenyl)sulfanyl-6-fluoro-2-methylindolizin-1-yl]acetate |
| SMILES | CCOC(=O)Cc1c(C)c(Sc2ccc(S(=O)(=O)CC)cc2)n2cc(F)ccc12 |
| InChI | InChI=1S/C21H22FNO4S2/c1-4-27-20(24)12-18-14(3)21(23-13-15(22)6-11-19(18)23)28-16-7-9-17(10-8-16)29(25,26)5-2/h6-11,13H,4-5,12H2,1-3H3 |
| InChIKey | WJZZYPVQMMEJLL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |