C24H21FN2O2S — CID 68588241
ethyl 2-[6-fluoro-2-methyl-3-(4-pyridin-2-ylphenyl)sulfanylindolizin-1-yl]acetate (PubChem CID 68588241) has the molecular formula C24H21FN2O2S and a molecular weight of 420.51 g/mol. Its IUPAC name is ethyl 2-[6-fluoro-2-methyl-3-(4-pyridin-2-ylphenyl)sulfanylindolizin-1-yl]acetate.
| Compound Name | ethyl 2-[6-fluoro-2-methyl-3-(4-pyridin-2-ylphenyl)sulfanylindolizin-1-yl]acetate |
|---|---|
| PubChem CID | 68588241 |
| Molecular Formula | C24H21FN2O2S |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | ethyl 2-[6-fluoro-2-methyl-3-(4-pyridin-2-ylphenyl)sulfanylindolizin-1-yl]acetate |
| SMILES | CCOC(=O)Cc1c(C)c(Sc2ccc(-c3ccccn3)cc2)n2cc(F)ccc12 |
| InChI | InChI=1S/C24H21FN2O2S/c1-3-29-23(28)14-20-16(2)24(27-15-18(25)9-12-22(20)27)30-19-10-7-17(8-11-19)21-6-4-5-13-26-21/h4-13,15H,3,14H2,1-2H3 |
| InChIKey | XYSKXYZEURWLAM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |