C22H17FN2O2S — CID 24991524
2-[6-fluoro-2-methyl-3-(4-pyridin-2-ylphenyl)sulfanylindolizin-1-yl]acetic acid (PubChem CID 24991524) has the molecular formula C22H17FN2O2S and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-[6-fluoro-2-methyl-3-(4-pyridin-2-ylphenyl)sulfanylindolizin-1-yl]acetic acid.
| Compound Name | 2-[6-fluoro-2-methyl-3-(4-pyridin-2-ylphenyl)sulfanylindolizin-1-yl]acetic acid |
|---|---|
| PubChem CID | 24991524 |
| Molecular Formula | C22H17FN2O2S |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-[6-fluoro-2-methyl-3-(4-pyridin-2-ylphenyl)sulfanylindolizin-1-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c2ccc(F)cn2c1Sc1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C22H17FN2O2S/c1-14-18(12-21(26)27)20-10-7-16(23)13-25(20)22(14)28-17-8-5-15(6-9-17)19-4-2-3-11-24-19/h2-11,13H,12H2,1H3,(H,26,27) |
| InChIKey | ZQXUTENACWNSDH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |