C16H17NO4 — CID 171866921
ethyl 2,3-dihydroxy-3-(4-pyridin-2-ylphenyl)propanoate (PubChem CID 171866921) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is ethyl 2,3-dihydroxy-3-(4-pyridin-2-ylphenyl)propanoate.
| Compound Name | ethyl 2,3-dihydroxy-3-(4-pyridin-2-ylphenyl)propanoate |
|---|---|
| PubChem CID | 171866921 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | ethyl 2,3-dihydroxy-3-(4-pyridin-2-ylphenyl)propanoate |
| SMILES | CCOC(=O)C(O)C(O)c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C16H17NO4/c1-2-21-16(20)15(19)14(18)12-8-6-11(7-9-12)13-5-3-4-10-17-13/h3-10,14-15,18-19H,2H2,1H3 |
| InChIKey | PVOKWWDSGGGKSW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |