C16H15Cl2FN2O2 — CID 58631087
2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-2-ylphenyl)propan-2-yl]acetamide (PubChem CID 58631087) has the molecular formula C16H15Cl2FN2O2 and a molecular weight of 357.21 g/mol. Its IUPAC name is 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-2-ylphenyl)propan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-2-ylphenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 58631087 |
| Molecular Formula | C16H15Cl2FN2O2 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-2-ylphenyl)propan-2-yl]acetamide |
| SMILES | O=C(N[C@H](CF)[C@H](O)c1ccc(-c2ccccn2)cc1)C(Cl)Cl |
| InChI | InChI=1S/C16H15Cl2FN2O2/c17-15(18)16(23)21-13(9-19)14(22)11-6-4-10(5-7-11)12-3-1-2-8-20-12/h1-8,13-15,22H,9H2,(H,21,23)/t13-,14-/m1/s1 |
| InChIKey | NFOVGTQBOIXACN-ZIAGYGMSSA-N |
| XLogP | 3.04 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|